C21H30FIN4S — CID 111286348
1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111286348) has the molecular formula C21H30FIN4S and a molecular weight of 516.47 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111286348 |
| Molecular Formula | C21H30FIN4S |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1CCN(Cc2cccs2)CC1)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C21H29FN4S.HI/c1-23-21(25(2)15-18-5-3-6-19(22)13-18)24-14-17-8-10-26(11-9-17)16-20-7-4-12-27-20;/h3-7,12-13,17H,8-11,14-16H2,1-2H3,(H,23,24);1H |
| InChIKey | DYHIGVLDSYXQHM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|