C18H30FN5 — CID 111286219
1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(4-methylpiperazin-1-yl)propyl]guanidine (PubChem CID 111286219) has the molecular formula C18H30FN5 and a molecular weight of 335.47 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(4-methylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(4-methylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111286219 |
| Molecular Formula | C18H30FN5 |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(4-methylpiperazin-1-yl)propyl]guanidine |
| SMILES | C/N=C(/NCC(C)N1CCN(C)CC1)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C18H30FN5/c1-15(24-10-8-22(3)9-11-24)13-21-18(20-2)23(4)14-16-6-5-7-17(19)12-16/h5-7,12,15H,8-11,13-14H2,1-4H3,(H,20,21) |
| InChIKey | NLTNQOIUOGCVKN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|