C18H21F2N3 — CID 111286469
3-[2-(3-fluorophenyl)ethyl]-1-[(3-fluorophenyl)methyl]-1,2-dimethylguanidine (PubChem CID 111286469) has the molecular formula C18H21F2N3 and a molecular weight of 317.38 g/mol. Its IUPAC name is 3-[2-(3-fluorophenyl)ethyl]-1-[(3-fluorophenyl)methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[2-(3-fluorophenyl)ethyl]-1-[(3-fluorophenyl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111286469 |
| Molecular Formula | C18H21F2N3 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 3-[2-(3-fluorophenyl)ethyl]-1-[(3-fluorophenyl)methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCCc1cccc(F)c1)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C18H21F2N3/c1-21-18(22-10-9-14-5-3-7-16(19)11-14)23(2)13-15-6-4-8-17(20)12-15/h3-8,11-12H,9-10,13H2,1-2H3,(H,21,22) |
| InChIKey | PVNZXPKJQABWBO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|