C17H24FIN4S — CID 111514283
3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1-[(3-fluorophenyl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111514283) has the molecular formula C17H24FIN4S and a molecular weight of 462.38 g/mol. Its IUPAC name is 3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1-[(3-fluorophenyl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1-[(3-fluorophenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111514283 |
| Molecular Formula | C17H24FIN4S |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1-[(3-fluorophenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCc1cnc(CCN/C(=N\C)N(C)Cc2cccc(F)c2)s1.I |
| InChI | InChI=1S/C17H23FN4S.HI/c1-4-15-11-21-16(23-15)8-9-20-17(19-2)22(3)12-13-6-5-7-14(18)10-13;/h5-7,10-11H,4,8-9,12H2,1-3H3,(H,19,20);1H |
| InChIKey | FEIFKZCVUSJPAI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|