C16H23FIN5 — CID 111286428
1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111286428) has the molecular formula C16H23FIN5 and a molecular weight of 431.30 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111286428 |
| Molecular Formula | C16H23FIN5 |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cnn(C)c1)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C16H22FN5.HI/c1-18-16(19-8-7-14-10-20-22(3)12-14)21(2)11-13-5-4-6-15(17)9-13;/h4-6,9-10,12H,7-8,11H2,1-3H3,(H,18,19);1H |
| InChIKey | KKEGUBGVKIZCHN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|