C20H23FIN5 — CID 111286134
1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111286134) has the molecular formula C20H23FIN5 and a molecular weight of 479.34 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111286134 |
| Molecular Formula | C20H23FIN5 |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-1,2-dimethyl-3-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cnn(-c2ccccc2)c1)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C20H22FN5.HI/c1-22-20(25(2)14-16-7-6-8-18(21)11-16)23-12-17-13-24-26(15-17)19-9-4-3-5-10-19;/h3-11,13,15H,12,14H2,1-2H3,(H,22,23);1H |
| InChIKey | USFGYOKIKGRUMK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|