C18H25N5 — CID 109499066
1,2-dimethyl-1-pent-4-enyl-3-[(1-phenylpyrazol-4-yl)methyl]guanidine (PubChem CID 109499066) has the molecular formula C18H25N5 and a molecular weight of 311.43 g/mol. Its IUPAC name is 1,2-dimethyl-1-pent-4-enyl-3-[(1-phenylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-1-pent-4-enyl-3-[(1-phenylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109499066 |
| Molecular Formula | C18H25N5 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 1,2-dimethyl-1-pent-4-enyl-3-[(1-phenylpyrazol-4-yl)methyl]guanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H25N5/c1-4-5-9-12-22(3)18(19-2)20-13-16-14-21-23(15-16)17-10-7-6-8-11-17/h4,6-8,10-11,14-15H,1,5,9,12-13H2,2-3H3,(H,19,20) |
| InChIKey | NPANSPCTEAYOCW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|