C17H24N6 — CID 109497928
1,2-dimethyl-1-pent-4-enyl-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine (PubChem CID 109497928) has the molecular formula C17H24N6 and a molecular weight of 312.42 g/mol. Its IUPAC name is 1,2-dimethyl-1-pent-4-enyl-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-1-pent-4-enyl-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 109497928 |
| Molecular Formula | C17H24N6 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 1,2-dimethyl-1-pent-4-enyl-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCc1ccnc(-n2cccn2)c1 |
| InChI | InChI=1S/C17H24N6/c1-4-5-6-11-22(3)17(18-2)20-14-15-8-10-19-16(13-15)23-12-7-9-21-23/h4,7-10,12-13H,1,5-6,11,14H2,2-3H3,(H,18,20) |
| InChIKey | WHDFAALFDGVGIU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|