C18H30IN5 — CID 109499481
1,2-dimethyl-1-pent-4-enyl-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 109499481) has the molecular formula C18H30IN5 and a molecular weight of 443.38 g/mol. Its IUPAC name is 1,2-dimethyl-1-pent-4-enyl-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-pent-4-enyl-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109499481 |
| Molecular Formula | C18H30IN5 |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 1,2-dimethyl-1-pent-4-enyl-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N\C)NCc1ccnc(N2CCCC2)c1.I |
| InChI | InChI=1S/C18H29N5.HI/c1-4-5-6-11-22(3)18(19-2)21-15-16-9-10-20-17(14-16)23-12-7-8-13-23;/h4,9-10,14H,1,5-8,11-13,15H2,2-3H3,(H,19,21);1H |
| InChIKey | ANZUIEWAMKARCO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|