C19H31N5O — CID 109498766
1,2-dimethyl-3-[[2-(2-methylmorpholin-4-yl)-4-pyridinyl]methyl]-1-pent-4-enylguanidine (PubChem CID 109498766) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is 1,2-dimethyl-3-[[2-(2-methylmorpholin-4-yl)-4-pyridinyl]methyl]-1-pent-4-enylguanidine.
| Compound Name | 1,2-dimethyl-3-[[2-(2-methylmorpholin-4-yl)-4-pyridinyl]methyl]-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109498766 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 1,2-dimethyl-3-[[2-(2-methylmorpholin-4-yl)-4-pyridinyl]methyl]-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCc1ccnc(N2CCOC(C)C2)c1 |
| InChI | InChI=1S/C19H31N5O/c1-5-6-7-10-23(4)19(20-3)22-14-17-8-9-21-18(13-17)24-11-12-25-16(2)15-24/h5,8-9,13,16H,1,6-7,10-12,14-15H2,2-4H3,(H,20,22) |
| InChIKey | RRDKTLMBOVVVME-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|