C19H31N5 — CID 109497734
1,2-dimethyl-1-pent-4-enyl-3-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine (PubChem CID 109497734) has the molecular formula C19H31N5 and a molecular weight of 329.49 g/mol. Its IUPAC name is 1,2-dimethyl-1-pent-4-enyl-3-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-1-pent-4-enyl-3-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 109497734 |
| Molecular Formula | C19H31N5 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | 1,2-dimethyl-1-pent-4-enyl-3-[(2-piperidin-1-yl-4-pyridinyl)methyl]guanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCc1ccnc(N2CCCCC2)c1 |
| InChI | InChI=1S/C19H31N5/c1-4-5-7-12-23(3)19(20-2)22-16-17-10-11-21-18(15-17)24-13-8-6-9-14-24/h4,10-11,15H,1,5-9,12-14,16H2,2-3H3,(H,20,22) |
| InChIKey | WLYSMNHQOZOQPM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|