C20H26BrN5 — CID 111293419
1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine (PubChem CID 111293419) has the molecular formula C20H26BrN5 and a molecular weight of 416.37 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine.
| Compound Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111293419 |
| Molecular Formula | C20H26BrN5 |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccnc(N2CCCC2)c1)N(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H26BrN5/c1-22-20(25(2)15-16-5-7-18(21)8-6-16)24-14-17-9-10-23-19(13-17)26-11-3-4-12-26/h5-10,13H,3-4,11-12,14-15H2,1-2H3,(H,22,24) |
| InChIKey | RKKRFYNAVKJNTM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|