C25H37N5O2 — CID 111983995
3-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylguanidine (PubChem CID 111983995) has the molecular formula C25H37N5O2 and a molecular weight of 439.60 g/mol. Its IUPAC name is 3-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylguanidine.
| Compound Name | 3-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111983995 |
| Molecular Formula | C25H37N5O2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | 3-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCc1ccnc(N2CCCCCC2)c1)N(C)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H37N5O2/c1-26-25(29(2)16-12-20-9-10-22(31-3)23(17-20)32-4)28-19-21-11-13-27-24(18-21)30-14-7-5-6-8-15-30/h9-11,13,17-18H,5-8,12,14-16,19H2,1-4H3,(H,26,28) |
| InChIKey | CUQDARSZRRMJMO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|