C18H28IN5O2 — CID 111241350
1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111241350) has the molecular formula C18H28IN5O2 and a molecular weight of 473.36 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111241350 |
| Molecular Formula | C18H28IN5O2 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccnn1C)N(C)CCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C18H27N5O2.HI/c1-19-18(20-13-15-8-10-21-23(15)3)22(2)11-9-14-6-7-16(24-4)17(12-14)25-5;/h6-8,10,12H,9,11,13H2,1-5H3,(H,19,20);1H |
| InChIKey | ZOIQQADDGKFOLS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|