C22H31IN4O3 — CID 111240934
4-[[[N-[2-(3,4-dimethoxyphenyl)ethyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-N-methylbenzamide;hydroiodide (PubChem CID 111240934) has the molecular formula C22H31IN4O3 and a molecular weight of 526.42 g/mol. Its IUPAC name is 4-[[[N-[2-(3,4-dimethoxyphenyl)ethyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 4-[[[N-[2-(3,4-dimethoxyphenyl)ethyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111240934 |
| Molecular Formula | C22H31IN4O3 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 4-[[[N-[2-(3,4-dimethoxyphenyl)ethyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-N-methylbenzamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C(=O)NC)cc1)N(C)CCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C22H30N4O3.HI/c1-23-21(27)18-9-6-17(7-10-18)15-25-22(24-2)26(3)13-12-16-8-11-19(28-4)20(14-16)29-5;/h6-11,14H,12-13,15H2,1-5H3,(H,23,27)(H,24,25);1H |
| InChIKey | VAKADLAPDFSOMI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|