C18H24BrN3O2S — CID 111241217
3-[(5-bromothiophen-2-yl)methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylguanidine (PubChem CID 111241217) has the molecular formula C18H24BrN3O2S and a molecular weight of 426.38 g/mol. Its IUPAC name is 3-[(5-bromothiophen-2-yl)methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylguanidine.
| Compound Name | 3-[(5-bromothiophen-2-yl)methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111241217 |
| Molecular Formula | C18H24BrN3O2S |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 3-[(5-bromothiophen-2-yl)methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCc1ccc(Br)s1)N(C)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H24BrN3O2S/c1-20-18(21-12-14-6-8-17(19)25-14)22(2)10-9-13-5-7-15(23-3)16(11-13)24-4/h5-8,11H,9-10,12H2,1-4H3,(H,20,21) |
| InChIKey | ARUWBGOQNYJNMW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|