C19H29IN6O2 — CID 111241546
3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111241546) has the molecular formula C19H29IN6O2 and a molecular weight of 500.39 g/mol. Its IUPAC name is 3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111241546 |
| Molecular Formula | C19H29IN6O2 |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nnc2n1CCC2)N(C)CCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C19H28N6O2.HI/c1-20-19(21-13-18-23-22-17-6-5-10-25(17)18)24(2)11-9-14-7-8-15(26-3)16(12-14)27-4;/h7-8,12H,5-6,9-11,13H2,1-4H3,(H,20,21);1H |
| InChIKey | UPCTWTUABOCBDH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|