C22H37N5O — CID 109490808
N',3-dimethyl-N-[[2-(2-methylmorpholin-4-yl)-4-pyridinyl]methyl]-3-propylpiperidine-1-carboximidamide (PubChem CID 109490808) has the molecular formula C22H37N5O and a molecular weight of 387.57 g/mol. Its IUPAC name is N',3-dimethyl-N-[[2-(2-methylmorpholin-4-yl)-4-pyridinyl]methyl]-3-propylpiperidine-1-carboximidamide.
| Compound Name | N',3-dimethyl-N-[[2-(2-methylmorpholin-4-yl)-4-pyridinyl]methyl]-3-propylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109490808 |
| Molecular Formula | C22H37N5O |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.30 |
| IUPAC Name | N',3-dimethyl-N-[[2-(2-methylmorpholin-4-yl)-4-pyridinyl]methyl]-3-propylpiperidine-1-carboximidamide |
| SMILES | CCCC1(C)CCCN(/C(=N/C)NCc2ccnc(N3CCOC(C)C3)c2)C1 |
| InChI | InChI=1S/C22H37N5O/c1-5-8-22(3)9-6-11-27(17-22)21(23-4)25-15-19-7-10-24-20(14-19)26-12-13-28-18(2)16-26/h7,10,14,18H,5-6,8-9,11-13,15-17H2,1-4H3,(H,23,25) |
| InChIKey | CZKVSRGYCBMCRN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|