C17H24N6O — CID 109383300
1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine (PubChem CID 109383300) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 109383300 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccnc(-n2cccn2)c1)N(C)CC1CCOC1 |
| InChI | InChI=1S/C17H24N6O/c1-18-17(22(2)12-15-5-9-24-13-15)20-11-14-4-7-19-16(10-14)23-8-3-6-21-23/h3-4,6-8,10,15H,5,9,11-13H2,1-2H3,(H,18,20) |
| InChIKey | INCAUBGBLYJPKB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|