C12H21IN4O2 — CID 109385180
1,2-dimethyl-3-(1,2-oxazol-3-ylmethyl)-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109385180) has the molecular formula C12H21IN4O2 and a molecular weight of 380.23 g/mol. Its IUPAC name is 1,2-dimethyl-3-(1,2-oxazol-3-ylmethyl)-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-(1,2-oxazol-3-ylmethyl)-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109385180 |
| Molecular Formula | C12H21IN4O2 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 1,2-dimethyl-3-(1,2-oxazol-3-ylmethyl)-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccon1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C12H20N4O2.HI/c1-13-12(14-7-11-4-6-18-15-11)16(2)8-10-3-5-17-9-10;/h4,6,10H,3,5,7-9H2,1-2H3,(H,13,14);1H |
| InChIKey | WMZBWFMMMFKBFQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|