C17H29IN4O2 — CID 109384712
1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 109384712) has the molecular formula C17H29IN4O2 and a molecular weight of 448.35 g/mol. Its IUPAC name is 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109384712 |
| Molecular Formula | C17H29IN4O2 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 1,2-dimethyl-1-(oxolan-3-ylmethyl)-3-[(6-propan-2-yloxy-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC(C)C)nc1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C17H28N4O2.HI/c1-13(2)23-16-6-5-14(9-19-16)10-20-17(18-3)21(4)11-15-7-8-22-12-15;/h5-6,9,13,15H,7-8,10-12H2,1-4H3,(H,18,20);1H |
| InChIKey | OLPWCJMHANWZLB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|