C17H28FIN4O — CID 109383249
3-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109383249) has the molecular formula C17H28FIN4O and a molecular weight of 450.34 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109383249 |
| Molecular Formula | C17H28FIN4O |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 3-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(N(C)C)c(F)c1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C17H27FN4O.HI/c1-19-17(22(4)11-14-7-8-23-12-14)20-10-13-5-6-16(21(2)3)15(18)9-13;/h5-6,9,14H,7-8,10-12H2,1-4H3,(H,19,20);1H |
| InChIKey | SQXJQNCLMJHBKQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|