C19H28IN3O3 — CID 109384636
3-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109384636) has the molecular formula C19H28IN3O3 and a molecular weight of 473.36 g/mol. Its IUPAC name is 3-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109384636 |
| Molecular Formula | C19H28IN3O3 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 3-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C#CCOc1cc(CN/C(=N/C)N(C)CC2CCOC2)ccc1OC.I |
| InChI | InChI=1S/C19H27N3O3.HI/c1-5-9-25-18-11-15(6-7-17(18)23-4)12-21-19(20-2)22(3)13-16-8-10-24-14-16;/h1,6-7,11,16H,8-10,12-14H2,2-4H3,(H,20,21);1H |
| InChIKey | QXHAYBXAUQZXLW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|