C14H26IN5OS — CID 109383753
3-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109383753) has the molecular formula C14H26IN5OS and a molecular weight of 439.37 g/mol. Its IUPAC name is 3-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109383753 |
| Molecular Formula | C14H26IN5OS |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 3-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1,2-dimethyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1csc(N(C)C)n1)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C14H25N5OS.HI/c1-15-13(19(4)8-11-5-6-20-9-11)16-7-12-10-21-14(17-12)18(2)3;/h10-11H,5-9H2,1-4H3,(H,15,16);1H |
| InChIKey | UOPLHPBFUCURPQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|