C14H23F3IN5O — CID 109385140
1,2-dimethyl-3-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109385140) has the molecular formula C14H23F3IN5O and a molecular weight of 461.27 g/mol. Its IUPAC name is 1,2-dimethyl-3-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109385140 |
| Molecular Formula | C14H23F3IN5O |
| Molecular Weight | 461.27 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 1,2-dimethyl-3-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cn(C)nc1C(F)(F)F)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C14H22F3N5O.HI/c1-18-13(21(2)7-10-4-5-23-9-10)19-6-11-8-22(3)20-12(11)14(15,16)17;/h8,10H,4-7,9H2,1-3H3,(H,18,19);1H |
| InChIKey | DVOGLMIBEONMLG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|