C18H23N5O2 — CID 94030793
1-cyclopropyl-1-[[(3S)-oxolan-3-yl]methyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea (PubChem CID 94030793) has the molecular formula C18H23N5O2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-cyclopropyl-1-[[(3S)-oxolan-3-yl]methyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea.
| Compound Name | 1-cyclopropyl-1-[[(3S)-oxolan-3-yl]methyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 94030793 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-cyclopropyl-1-[[(3S)-oxolan-3-yl]methyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea |
| SMILES | O=C(NCc1ccnc(-n2cccn2)c1)N(C[C@@H]1CCOC1)C1CC1 |
| InChI | InChI=1S/C18H23N5O2/c24-18(22(16-2-3-16)12-15-5-9-25-13-15)20-11-14-4-7-19-17(10-14)23-8-1-6-21-23/h1,4,6-8,10,15-16H,2-3,5,9,11-13H2,(H,20,24)/t15-/m0/s1 |
| InChIKey | OGSVOIVWNOTCLQ-HNNXBMFYSA-N |
| XLogP | 1.98 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |