C15H23N5O2 — CID 94124059
1-cyclopropyl-1-[[(3S)-oxolan-3-yl]methyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea (PubChem CID 94124059) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-cyclopropyl-1-[[(3S)-oxolan-3-yl]methyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea.
| Compound Name | 1-cyclopropyl-1-[[(3S)-oxolan-3-yl]methyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea |
|---|---|
| PubChem CID | 94124059 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 1-cyclopropyl-1-[[(3S)-oxolan-3-yl]methyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea |
| SMILES | O=C(NCCNc1ncccn1)N(C[C@@H]1CCOC1)C1CC1 |
| InChI | InChI=1S/C15H23N5O2/c21-15(19-8-7-18-14-16-5-1-6-17-14)20(13-2-3-13)10-12-4-9-22-11-12/h1,5-6,12-13H,2-4,7-11H2,(H,19,21)(H,16,17,18)/t12-/m0/s1 |
| InChIKey | FQWGHCSJNZQRFO-LBPRGKRZSA-N |
| XLogP | 1.10 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|