C19H27N5 — CID 109497726
1,2-dimethyl-1-pent-4-enyl-3-[2-(1-phenylpyrazol-4-yl)ethyl]guanidine (PubChem CID 109497726) has the molecular formula C19H27N5 and a molecular weight of 325.46 g/mol. Its IUPAC name is 1,2-dimethyl-1-pent-4-enyl-3-[2-(1-phenylpyrazol-4-yl)ethyl]guanidine.
| Compound Name | 1,2-dimethyl-1-pent-4-enyl-3-[2-(1-phenylpyrazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 109497726 |
| Molecular Formula | C19H27N5 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | 1,2-dimethyl-1-pent-4-enyl-3-[2-(1-phenylpyrazol-4-yl)ethyl]guanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H27N5/c1-4-5-9-14-23(3)19(20-2)21-13-12-17-15-22-24(16-17)18-10-7-6-8-11-18/h4,6-8,10-11,15-16H,1,5,9,12-14H2,2-3H3,(H,20,21) |
| InChIKey | WJHZCGLOSZGUHK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|