C19H24N6 — CID 119154840
1,2-dimethyl-3-[(1-methylpyrrol-2-yl)methyl]-1-[(1-phenylpyrazol-4-yl)methyl]guanidine (PubChem CID 119154840) has the molecular formula C19H24N6 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(1-methylpyrrol-2-yl)methyl]-1-[(1-phenylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[(1-methylpyrrol-2-yl)methyl]-1-[(1-phenylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119154840 |
| Molecular Formula | C19H24N6 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 1,2-dimethyl-3-[(1-methylpyrrol-2-yl)methyl]-1-[(1-phenylpyrazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1cccn1C)N(C)Cc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H24N6/c1-20-19(21-13-18-10-7-11-23(18)2)24(3)14-16-12-22-25(15-16)17-8-5-4-6-9-17/h4-12,15H,13-14H2,1-3H3,(H,20,21) |
| InChIKey | YXNMDSBAWSJGGV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|