C23H32N8 — CID 111414715
1,2-dimethyl-1-[(1-phenylpyrazol-4-yl)methyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine (PubChem CID 111414715) has the molecular formula C23H32N8 and a molecular weight of 420.57 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(1-phenylpyrazol-4-yl)methyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine.
| Compound Name | 1,2-dimethyl-1-[(1-phenylpyrazol-4-yl)methyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111414715 |
| Molecular Formula | C23H32N8 |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | 1,2-dimethyl-1-[(1-phenylpyrazol-4-yl)methyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCc1nnc2n1CCCCC2)N(C)Cc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C23H32N8/c1-24-23(25-14-9-13-22-28-27-21-12-7-4-8-15-30(21)22)29(2)17-19-16-26-31(18-19)20-10-5-3-6-11-20/h3,5-6,10-11,16,18H,4,7-9,12-15,17H2,1-2H3,(H,24,25) |
| InChIKey | ODJGGASOHIMDPO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|