C22H31IN6O — CID 111694843
1-(1-benzofuran-2-ylmethyl)-1,2-dimethyl-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide (PubChem CID 111694843) has the molecular formula C22H31IN6O and a molecular weight of 522.44 g/mol. Its IUPAC name is 1-(1-benzofuran-2-ylmethyl)-1,2-dimethyl-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(1-benzofuran-2-ylmethyl)-1,2-dimethyl-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111694843 |
| Molecular Formula | C22H31IN6O |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 1-(1-benzofuran-2-ylmethyl)-1,2-dimethyl-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1nnc2n1CCCCC2)N(C)Cc1cc2ccccc2o1.I |
| InChI | InChI=1S/C22H30N6O.HI/c1-23-22(27(2)16-18-15-17-9-5-6-10-19(17)29-18)24-13-8-12-21-26-25-20-11-4-3-7-14-28(20)21;/h5-6,9-10,15H,3-4,7-8,11-14,16H2,1-2H3,(H,23,24);1H |
| InChIKey | FQUWISYCAOATCE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|