C18H25N3O2 — CID 119155081
1-(1-benzofuran-2-ylmethyl)-3-[(2-hydroxycyclopentyl)methyl]-1,2-dimethylguanidine (PubChem CID 119155081) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 1-(1-benzofuran-2-ylmethyl)-3-[(2-hydroxycyclopentyl)methyl]-1,2-dimethylguanidine.
| Compound Name | 1-(1-benzofuran-2-ylmethyl)-3-[(2-hydroxycyclopentyl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 119155081 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 1-(1-benzofuran-2-ylmethyl)-3-[(2-hydroxycyclopentyl)methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCC1CCCC1O)N(C)Cc1cc2ccccc2o1 |
| InChI | InChI=1S/C18H25N3O2/c1-19-18(20-11-14-7-5-8-16(14)22)21(2)12-15-10-13-6-3-4-9-17(13)23-15/h3-4,6,9-10,14,16,22H,5,7-8,11-12H2,1-2H3,(H,19,20) |
| InChIKey | XXFYGIFNPYHMSV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|