C14H24N4O — CID 119155099
3-[(2-hydroxycyclopentyl)methyl]-1,2-dimethyl-1-(1H-pyrrol-2-ylmethyl)guanidine (PubChem CID 119155099) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 3-[(2-hydroxycyclopentyl)methyl]-1,2-dimethyl-1-(1H-pyrrol-2-ylmethyl)guanidine.
| Compound Name | 3-[(2-hydroxycyclopentyl)methyl]-1,2-dimethyl-1-(1H-pyrrol-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119155099 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 3-[(2-hydroxycyclopentyl)methyl]-1,2-dimethyl-1-(1H-pyrrol-2-ylmethyl)guanidine |
| SMILES | C/N=C(/NCC1CCCC1O)N(C)Cc1ccc[nH]1 |
| InChI | InChI=1S/C14H24N4O/c1-15-14(17-9-11-5-3-7-13(11)19)18(2)10-12-6-4-8-16-12/h4,6,8,11,13,16,19H,3,5,7,9-10H2,1-2H3,(H,15,17) |
| InChIKey | MQMPDRNYOADPMV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|