C14H25N5S — CID 119153728
1,2-dimethyl-1-(1H-pyrrol-2-ylmethyl)-3-(2-thiomorpholin-4-ylethyl)guanidine (PubChem CID 119153728) has the molecular formula C14H25N5S and a molecular weight of 295.46 g/mol. Its IUPAC name is 1,2-dimethyl-1-(1H-pyrrol-2-ylmethyl)-3-(2-thiomorpholin-4-ylethyl)guanidine.
| Compound Name | 1,2-dimethyl-1-(1H-pyrrol-2-ylmethyl)-3-(2-thiomorpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 119153728 |
| Molecular Formula | C14H25N5S |
| Molecular Weight | 295.46 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 1,2-dimethyl-1-(1H-pyrrol-2-ylmethyl)-3-(2-thiomorpholin-4-ylethyl)guanidine |
| SMILES | C/N=C(/NCCN1CCSCC1)N(C)Cc1ccc[nH]1 |
| InChI | InChI=1S/C14H25N5S/c1-15-14(18(2)12-13-4-3-5-16-13)17-6-7-19-8-10-20-11-9-19/h3-5,16H,6-12H2,1-2H3,(H,15,17) |
| InChIKey | PIELMRNCEFOYOO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 46.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.46 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|