C14H23ClN4S2 — CID 119153470
1-[(5-chlorothiophen-2-yl)methyl]-1,2-dimethyl-3-(2-thiomorpholin-4-ylethyl)guanidine (PubChem CID 119153470) has the molecular formula C14H23ClN4S2 and a molecular weight of 346.95 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-1,2-dimethyl-3-(2-thiomorpholin-4-ylethyl)guanidine.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-1,2-dimethyl-3-(2-thiomorpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 119153470 |
| Molecular Formula | C14H23ClN4S2 |
| Molecular Weight | 346.95 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-1,2-dimethyl-3-(2-thiomorpholin-4-ylethyl)guanidine |
| SMILES | C/N=C(/NCCN1CCSCC1)N(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C14H23ClN4S2/c1-16-14(17-5-6-19-7-9-20-10-8-19)18(2)11-12-3-4-13(15)21-12/h3-4H,5-11H2,1-2H3,(H,16,17) |
| InChIKey | UAJWGFNVSJPLKS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.95 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|