C16H20ClN3OS — CID 119132914
1-[(5-chlorothiophen-2-yl)methyl]-3-(2-hydroxy-2-phenylethyl)-1,2-dimethylguanidine (PubChem CID 119132914) has the molecular formula C16H20ClN3OS and a molecular weight of 337.88 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-3-(2-hydroxy-2-phenylethyl)-1,2-dimethylguanidine.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-(2-hydroxy-2-phenylethyl)-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 119132914 |
| Molecular Formula | C16H20ClN3OS |
| Molecular Weight | 337.88 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-3-(2-hydroxy-2-phenylethyl)-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCC(O)c1ccccc1)N(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C16H20ClN3OS/c1-18-16(20(2)11-13-8-9-15(17)22-13)19-10-14(21)12-6-4-3-5-7-12/h3-9,14,21H,10-11H2,1-2H3,(H,18,19) |
| InChIKey | DHNCJQIZPRFYPD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.88 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|