C15H25ClN4OS — CID 111363291
N-[2-[[N-[(5-chlorothiophen-2-yl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 111363291) has the molecular formula C15H25ClN4OS and a molecular weight of 344.91 g/mol. Its IUPAC name is N-[2-[[N-[(5-chlorothiophen-2-yl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[N-[(5-chlorothiophen-2-yl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111363291 |
| Molecular Formula | C15H25ClN4OS |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-[2-[[N-[(5-chlorothiophen-2-yl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | C/N=C(\NCCNC(=O)C(C)(C)C)N(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C15H25ClN4OS/c1-15(2,3)13(21)18-8-9-19-14(17-4)20(5)10-11-6-7-12(16)22-11/h6-7H,8-10H2,1-5H3,(H,17,19)(H,18,21) |
| InChIKey | YQBACYSOWCEAMA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|