C13H19ClF3IN4OS — CID 111501242
2-[[N-[(5-chlorothiophen-2-yl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide (PubChem CID 111501242) has the molecular formula C13H19ClF3IN4OS and a molecular weight of 498.74 g/mol. Its IUPAC name is 2-[[N-[(5-chlorothiophen-2-yl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-[(5-chlorothiophen-2-yl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111501242 |
| Molecular Formula | C13H19ClF3IN4OS |
| Molecular Weight | 498.74 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | 2-[[N-[(5-chlorothiophen-2-yl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)N(C)CC(F)(F)F)N(C)Cc1ccc(Cl)s1.I |
| InChI | InChI=1S/C13H18ClF3N4OS.HI/c1-18-12(20(2)7-9-4-5-10(14)23-9)19-6-11(22)21(3)8-13(15,16)17;/h4-5H,6-8H2,1-3H3,(H,18,19);1H |
| InChIKey | WAVBNEJKSVOQOF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.74 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|