C9H7ClF5NOS — CID 114038099
N-[(5-chlorothiophen-2-yl)methyl]-2,2,3,3,3-pentafluoro-N-methylpropanamide (PubChem CID 114038099) has the molecular formula C9H7ClF5NOS and a molecular weight of 307.67 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2,2,3,3,3-pentafluoro-N-methylpropanamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2,2,3,3,3-pentafluoro-N-methylpropanamide |
|---|---|
| PubChem CID | 114038099 |
| Molecular Formula | C9H7ClF5NOS |
| Molecular Weight | 307.67 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2,2,3,3,3-pentafluoro-N-methylpropanamide |
| SMILES | CN(Cc1ccc(Cl)s1)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H7ClF5NOS/c1-16(4-5-2-3-6(10)18-5)7(17)8(11,12)9(13,14)15/h2-3H,4H2,1H3 |
| InChIKey | MSRRHUZPJIAZKU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.67 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|