C11H10F5NO — CID 91699922
N-benzyl-2,2,3,3,3-pentafluoro-N-methylpropanamide (PubChem CID 91699922) has the molecular formula C11H10F5NO and a molecular weight of 267.20 g/mol. Its IUPAC name is N-benzyl-2,2,3,3,3-pentafluoro-N-methylpropanamide.
| Compound Name | N-benzyl-2,2,3,3,3-pentafluoro-N-methylpropanamide |
|---|---|
| PubChem CID | 91699922 |
| Molecular Formula | C11H10F5NO |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | N-benzyl-2,2,3,3,3-pentafluoro-N-methylpropanamide |
| SMILES | CN(Cc1ccccc1)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H10F5NO/c1-17(7-8-5-3-2-4-6-8)9(18)10(12,13)11(14,15)16/h2-6H,7H2,1H3 |
| InChIKey | BOCLSRLRQIRACH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|