C11H15F3N2O3 — CID 90893510
N-benzyl-2,2,2-trifluoro-N-methylacetamide;O-methoxyhydroxylamine (PubChem CID 90893510) has the molecular formula C11H15F3N2O3 and a molecular weight of 280.25 g/mol. Its IUPAC name is N-benzyl-2,2,2-trifluoro-N-methylacetamide;O-methoxyhydroxylamine.
| Compound Name | N-benzyl-2,2,2-trifluoro-N-methylacetamide;O-methoxyhydroxylamine |
|---|---|
| PubChem CID | 90893510 |
| Molecular Formula | C11H15F3N2O3 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | N-benzyl-2,2,2-trifluoro-N-methylacetamide;O-methoxyhydroxylamine |
| SMILES | CN(Cc1ccccc1)C(=O)C(F)(F)F.COON |
| InChI | InChI=1S/C10H10F3NO.CH5NO2/c1-14(9(15)10(11,12)13)7-8-5-3-2-4-6-8;1-3-4-2/h2-6H,7H2,1H3;2H2,1H3 |
| InChIKey | FNGARFYGWKDVRW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|