C12H15F3N2O — CID 62492005
N-[[4-(dimethylamino)phenyl]methyl]-2,2,2-trifluoro-N-methylacetamide (PubChem CID 62492005) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2,2,2-trifluoro-N-methylacetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2,2,2-trifluoro-N-methylacetamide |
|---|---|
| PubChem CID | 62492005 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2,2,2-trifluoro-N-methylacetamide |
| SMILES | CN(Cc1ccc(N(C)C)cc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O/c1-16(2)10-6-4-9(5-7-10)8-17(3)11(18)12(13,14)15/h4-7H,8H2,1-3H3 |
| InChIKey | ZJYQXMOVKXUHHE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|