C18H19F3N2O3S — CID 35746005
N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-4-(trifluoromethylsulfonyl)benzamide (PubChem CID 35746005) has the molecular formula C18H19F3N2O3S and a molecular weight of 400.42 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-4-(trifluoromethylsulfonyl)benzamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-4-(trifluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 35746005 |
| Molecular Formula | C18H19F3N2O3S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-methyl-4-(trifluoromethylsulfonyl)benzamide |
| SMILES | CN(Cc1ccc(N(C)C)cc1)C(=O)c1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H19F3N2O3S/c1-22(2)15-8-4-13(5-9-15)12-23(3)17(24)14-6-10-16(11-7-14)27(25,26)18(19,20)21/h4-11H,12H2,1-3H3 |
| InChIKey | WTXNIPXFRUHFCX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|