C19H20F3NO4S — CID 55761591
N-methyl-4-propan-2-ylsulfonyl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide (PubChem CID 55761591) has the molecular formula C19H20F3NO4S and a molecular weight of 415.43 g/mol. Its IUPAC name is N-methyl-4-propan-2-ylsulfonyl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | N-methyl-4-propan-2-ylsulfonyl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55761591 |
| Molecular Formula | C19H20F3NO4S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-methyl-4-propan-2-ylsulfonyl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
| SMILES | CC(C)S(=O)(=O)c1ccc(C(=O)N(C)Cc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H20F3NO4S/c1-13(2)28(25,26)17-10-6-15(7-11-17)18(24)23(3)12-14-4-8-16(9-5-14)27-19(20,21)22/h4-11,13H,12H2,1-3H3 |
| InChIKey | AOMYVIUQEIAOJL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |