C18H30F3NO2 — CID 143270772
N,N-di(propan-2-yl)-4-(trifluoromethoxy)benzamide;ethane (PubChem CID 143270772) has the molecular formula C18H30F3NO2 and a molecular weight of 349.44 g/mol. Its IUPAC name is N,N-di(propan-2-yl)-4-(trifluoromethoxy)benzamide;ethane.
| Compound Name | N,N-di(propan-2-yl)-4-(trifluoromethoxy)benzamide;ethane |
|---|---|
| PubChem CID | 143270772 |
| Molecular Formula | C18H30F3NO2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | N,N-di(propan-2-yl)-4-(trifluoromethoxy)benzamide;ethane |
| SMILES | CC.CC.CC(C)N(C(=O)c1ccc(OC(F)(F)F)cc1)C(C)C |
| InChI | InChI=1S/C14H18F3NO2.2C2H6/c1-9(2)18(10(3)4)13(19)11-5-7-12(8-6-11)20-14(15,16)17;2*1-2/h5-10H,1-4H3;2*1-2H3 |
| InChIKey | AQLMQPSYXHUCQP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |