C16H22F3NO2 — CID 59614232
N,N-ditert-butyl-4-(trifluoromethoxy)benzamide (PubChem CID 59614232) has the molecular formula C16H22F3NO2 and a molecular weight of 317.35 g/mol. Its IUPAC name is N,N-ditert-butyl-4-(trifluoromethoxy)benzamide.
| Compound Name | N,N-ditert-butyl-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 59614232 |
| Molecular Formula | C16H22F3NO2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N,N-ditert-butyl-4-(trifluoromethoxy)benzamide |
| SMILES | CC(C)(C)N(C(=O)c1ccc(OC(F)(F)F)cc1)C(C)(C)C |
| InChI | InChI=1S/C16H22F3NO2/c1-14(2,3)20(15(4,5)6)13(21)11-7-9-12(10-8-11)22-16(17,18)19/h7-10H,1-6H3 |
| InChIKey | ZCZIYLFCMQDGOA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |