C15H14F3NO3S2 — CID 55567347
N-methyl-N-[(3-methylthiophen-2-yl)methyl]-4-(trifluoromethylsulfonyl)benzamide (PubChem CID 55567347) has the molecular formula C15H14F3NO3S2 and a molecular weight of 377.41 g/mol. Its IUPAC name is N-methyl-N-[(3-methylthiophen-2-yl)methyl]-4-(trifluoromethylsulfonyl)benzamide.
| Compound Name | N-methyl-N-[(3-methylthiophen-2-yl)methyl]-4-(trifluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 55567347 |
| Molecular Formula | C15H14F3NO3S2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-methyl-N-[(3-methylthiophen-2-yl)methyl]-4-(trifluoromethylsulfonyl)benzamide |
| SMILES | Cc1ccsc1CN(C)C(=O)c1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H14F3NO3S2/c1-10-7-8-23-13(10)9-19(2)14(20)11-3-5-12(6-4-11)24(21,22)15(16,17)18/h3-8H,9H2,1-2H3 |
| InChIKey | ZWGBDPGPAJWOFK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |