C19H24N2O3S — CID 27861266
N-[[4-(dimethylamino)phenyl]methyl]-N,2-dimethyl-5-methylsulfonylbenzamide (PubChem CID 27861266) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N,2-dimethyl-5-methylsulfonylbenzamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N,2-dimethyl-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 27861266 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N,2-dimethyl-5-methylsulfonylbenzamide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)N(C)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H24N2O3S/c1-14-6-11-17(25(5,23)24)12-18(14)19(22)21(4)13-15-7-9-16(10-8-15)20(2)3/h6-12H,13H2,1-5H3 |
| InChIKey | ZFKLZZIEKOQEAB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|