C16H19BrN2OS — CID 79959540
5-bromo-N-[[4-(dimethylamino)phenyl]methyl]-N,4-dimethylthiophene-2-carboxamide (PubChem CID 79959540) has the molecular formula C16H19BrN2OS and a molecular weight of 367.31 g/mol. Its IUPAC name is 5-bromo-N-[[4-(dimethylamino)phenyl]methyl]-N,4-dimethylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[[4-(dimethylamino)phenyl]methyl]-N,4-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79959540 |
| Molecular Formula | C16H19BrN2OS |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 5-bromo-N-[[4-(dimethylamino)phenyl]methyl]-N,4-dimethylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)Cc2ccc(N(C)C)cc2)sc1Br |
| InChI | InChI=1S/C16H19BrN2OS/c1-11-9-14(21-15(11)17)16(20)19(4)10-12-5-7-13(8-6-12)18(2)3/h5-9H,10H2,1-4H3 |
| InChIKey | BJFHLMHMXLERGP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|