C16H20N2OS — CID 78800736
N-[[4-(dimethylamino)phenyl]methyl]-N,5-dimethylthiophene-2-carboxamide (PubChem CID 78800736) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N,5-dimethylthiophene-2-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N,5-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 78800736 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N,5-dimethylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N(C)Cc2ccc(N(C)C)cc2)s1 |
| InChI | InChI=1S/C16H20N2OS/c1-12-5-10-15(20-12)16(19)18(4)11-13-6-8-14(9-7-13)17(2)3/h5-10H,11H2,1-4H3 |
| InChIKey | DFFGRLFAOUWKMG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|